examples of multifunctional compounds
| CH3CH(OH)CH2CO2H | : | 3-hydroxybutanoic acid; |
| HOCH2CH2CH2COCH3 | : | 5-hydroxypentan-2-one; |
| CH3CH(OH)CH2C(CH3)(NH2)CH3 | : | 4-amino-4-methylpentan-2-ol |
| CH3COCO2H | : | 2-oxopropanoic* acid |
| CH2=CHCH(OH)CH3 | : | but-3-en-2-ol |
CH3C CCH2COOH |
: | pent-3-yn-oic acid. |
* the =O of an aldehyde or ketone is called oxo when it has to be named as a substituent.
The carbon-carbon double and triple bonds are always incorporated in the chain, with lower priority than the other groups.
